About (4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-amine
(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 18594316) has the molecular formula C4H8N2O
and a molecular weight of 100.12 g/mol. Its IUPAC name is (4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-amine.
Molecular Properties
| Compound Name | (4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-amine |
| PubChem CID | 18594316 |
| Molecular Formula | C4H8N2O |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.06 |
| IUPAC Name | (4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | C[C@H]1COC(N)=N1 |
| InChI | InChI=1S/C4H8N2O/c1-3-2-7-4(5)6-3/h3H,2H2,1H3,(H2,5,6)/t3-/m0/s1 |
| InChIKey | PIXPFRMNXPKTFS-VKHMYHEASA-N |
| XLogP | -0.28 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-amine?
The IUPAC name of (4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-amine (CID 18594316) is (4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-amine.
What is the SMILES notation for (4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-amine?
The canonical SMILES for (4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-amine is C[C@H]1COC(N)=N1.
What is the InChIKey of (4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-amine?
The InChIKey is PIXPFRMNXPKTFS-VKHMYHEASA-N. The full InChI is InChI=1S/C4H8N2O/c1-3-2-7-4(5)6-3/h3H,2H2,1H3,(H2,5,6)/t3-/m0/s1.
What are the key properties of (4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-amine?
(4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-amine has a molecular weight of 100.12 g/mol, XLogP of -0.28, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-methyl-4,5-dihydro-1,3-oxazol-2-amine is sourced from PubChem (CID 18594316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).