C23H42O5 — CID 18594570
7-[(8S,9R)-8-(3-hydroxy-3-methyloctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid (PubChem CID 18594570) has the molecular formula C23H42O5 and a molecular weight of 398.58 g/mol. Its IUPAC name is 7-[(8S,9R)-8-(3-hydroxy-3-methyloctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid.
| Compound Name | 7-[(8S,9R)-8-(3-hydroxy-3-methyloctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid |
|---|---|
| PubChem CID | 18594570 |
| Molecular Formula | C23H42O5 |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | 7-[(8S,9R)-8-(3-hydroxy-3-methyloctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid |
| SMILES | CCCCCC(C)(O)CC[C@H]1CCC2(OCCO2)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C23H42O5/c1-3-4-9-14-22(2,26)15-12-19-13-16-23(27-17-18-28-23)20(19)10-7-5-6-8-11-21(24)25/h19-20,26H,3-18H2,1-2H3,(H,24,25)/t19-,20+,22?/m0/s1 |
| InChIKey | FYKBZQXZGYBYSN-RJKSWSIASA-N |
| XLogP | 5.29 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|