C22H40O5 — CID 18594571
7-[(8S,9R)-8-(3-hydroxyoctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid (PubChem CID 18594571) has the molecular formula C22H40O5 and a molecular weight of 384.56 g/mol. Its IUPAC name is 7-[(8S,9R)-8-(3-hydroxyoctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid.
| Compound Name | 7-[(8S,9R)-8-(3-hydroxyoctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid |
|---|---|
| PubChem CID | 18594571 |
| Molecular Formula | C22H40O5 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | 7-[(8S,9R)-8-(3-hydroxyoctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoic acid |
| SMILES | CCCCCC(O)CC[C@H]1CCC2(OCCO2)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C22H40O5/c1-2-3-6-9-19(23)13-12-18-14-15-22(26-16-17-27-22)20(18)10-7-4-5-8-11-21(24)25/h18-20,23H,2-17H2,1H3,(H,24,25)/t18-,19?,20+/m0/s1 |
| InChIKey | ZCVSZVKVYOGQOI-SJBAFXMYSA-N |
| XLogP | 4.90 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|