About methyl 7-[(8S,9R)-8-(3-oxooctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate
methyl 7-[(8S,9R)-8-(3-oxooctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate (PubChem CID 18594628) has the molecular formula C23H40O5
and a molecular weight of 396.57 g/mol. Its IUPAC name is methyl 7-[(8S,9R)-8-(3-oxooctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate.
Molecular Properties
| Compound Name | methyl 7-[(8S,9R)-8-(3-oxooctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate |
| PubChem CID | 18594628 |
| Molecular Formula | C23H40O5 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | methyl 7-[(8S,9R)-8-(3-oxooctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate |
| SMILES | CCCCCC(=O)CC[C@H]1CCC2(OCCO2)[C@@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C23H40O5/c1-3-4-7-10-20(24)14-13-19-15-16-23(27-17-18-28-23)21(19)11-8-5-6-9-12-22(25)26-2/h19,21H,3-18H2,1-2H3/t19-,21+/m0/s1 |
| InChIKey | MCLVFFBJKFQXSU-PZJWPPBQSA-N |
| XLogP | 5.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-[(8S,9R)-8-(3-oxooctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-[(8S,9R)-8-(3-oxooctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate?
The IUPAC name of methyl 7-[(8S,9R)-8-(3-oxooctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate (CID 18594628) is methyl 7-[(8S,9R)-8-(3-oxooctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate.
What is the SMILES notation for methyl 7-[(8S,9R)-8-(3-oxooctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate?
The canonical SMILES for methyl 7-[(8S,9R)-8-(3-oxooctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate is CCCCCC(=O)CC[C@H]1CCC2(OCCO2)[C@@H]1CCCCCCC(=O)OC.
What is the InChIKey of methyl 7-[(8S,9R)-8-(3-oxooctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate?
The InChIKey is MCLVFFBJKFQXSU-PZJWPPBQSA-N. The full InChI is InChI=1S/C23H40O5/c1-3-4-7-10-20(24)14-13-19-15-16-23(27-17-18-28-23)21(19)11-8-5-6-9-12-22(25)26-2/h19,21H,3-18H2,1-2H3/t19-,21+/m0/s1.
What are the key properties of methyl 7-[(8S,9R)-8-(3-oxooctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate?
methyl 7-[(8S,9R)-8-(3-oxooctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate has a molecular weight of 396.57 g/mol, XLogP of 5.20, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-[(8S,9R)-8-(3-oxooctyl)-1,4-dioxaspiro[4.4]nonan-9-yl]heptanoate is sourced from PubChem (CID 18594628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).