C20H37FO4 — CID 18594644
7-[(1R,2R,5R)-2-[(3S)-4-fluoro-3-hydroxyoctyl]-5-hydroxycyclopentyl]heptanoic acid (PubChem CID 18594644) has the molecular formula C20H37FO4 and a molecular weight of 360.51 g/mol. Its IUPAC name is 7-[(1R,2R,5R)-2-[(3S)-4-fluoro-3-hydroxyoctyl]-5-hydroxycyclopentyl]heptanoic acid.
| Compound Name | 7-[(1R,2R,5R)-2-[(3S)-4-fluoro-3-hydroxyoctyl]-5-hydroxycyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 18594644 |
| Molecular Formula | C20H37FO4 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | 7-[(1R,2R,5R)-2-[(3S)-4-fluoro-3-hydroxyoctyl]-5-hydroxycyclopentyl]heptanoic acid |
| SMILES | CCCCC(F)[C@@H](O)CC[C@H]1CC[C@@H](O)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C20H37FO4/c1-2-3-9-17(21)19(23)14-12-15-11-13-18(22)16(15)8-6-4-5-7-10-20(24)25/h15-19,22-23H,2-14H2,1H3,(H,24,25)/t15-,16-,17?,18-,19+/m1/s1 |
| InChIKey | YCFUDOSKPXWSIE-SCIMBWJRSA-N |
| XLogP | 4.47 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|