C27H50O4 — CID 18594683
propan-2-yl 7-[(1R,2S)-2-[3-[(2-methylpropan-2-yl)oxy]octyl]-5-oxocyclopentyl]heptanoate (PubChem CID 18594683) has the molecular formula C27H50O4 and a molecular weight of 438.69 g/mol. Its IUPAC name is propan-2-yl 7-[(1R,2S)-2-[3-[(2-methylpropan-2-yl)oxy]octyl]-5-oxocyclopentyl]heptanoate.
| Compound Name | propan-2-yl 7-[(1R,2S)-2-[3-[(2-methylpropan-2-yl)oxy]octyl]-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 18594683 |
| Molecular Formula | C27H50O4 |
| Molecular Weight | 438.69 g/mol |
| Exact Mass | 438.37 |
| IUPAC Name | propan-2-yl 7-[(1R,2S)-2-[3-[(2-methylpropan-2-yl)oxy]octyl]-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCCC(CC[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)OC(C)C)OC(C)(C)C |
| InChI | InChI=1S/C27H50O4/c1-7-8-11-14-23(31-27(4,5)6)19-17-22-18-20-25(28)24(22)15-12-9-10-13-16-26(29)30-21(2)3/h21-24H,7-20H2,1-6H3/t22-,23?,24+/m0/s1 |
| InChIKey | YLZJEBXACXPTPV-LIDAZEJRSA-N |
| XLogP | 7.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.69 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|