C25H46O4 — CID 18594689
methyl 7-[(1R,2S)-2-[3-[(2-methylpropan-2-yl)oxy]octyl]-5-oxocyclopentyl]heptanoate (PubChem CID 18594689) has the molecular formula C25H46O4 and a molecular weight of 410.64 g/mol. Its IUPAC name is methyl 7-[(1R,2S)-2-[3-[(2-methylpropan-2-yl)oxy]octyl]-5-oxocyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2S)-2-[3-[(2-methylpropan-2-yl)oxy]octyl]-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 18594689 |
| Molecular Formula | C25H46O4 |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.34 |
| IUPAC Name | methyl 7-[(1R,2S)-2-[3-[(2-methylpropan-2-yl)oxy]octyl]-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCCC(CC[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)OC)OC(C)(C)C |
| InChI | InChI=1S/C25H46O4/c1-6-7-10-13-21(29-25(2,3)4)18-16-20-17-19-23(26)22(20)14-11-8-9-12-15-24(27)28-5/h20-22H,6-19H2,1-5H3/t20-,21?,22+/m0/s1 |
| InChIKey | BVLQAPMKBXVJPB-JAFNVKOHSA-N |
| XLogP | 6.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|