About ethyl 7-[(1R,2R)-2-(3-acetylsulfanyloctyl)-5-oxocyclopentyl]heptanoate
ethyl 7-[(1R,2R)-2-(3-acetylsulfanyloctyl)-5-oxocyclopentyl]heptanoate (PubChem CID 18594874) has the molecular formula C24H42O4S
and a molecular weight of 426.66 g/mol. Its IUPAC name is ethyl 7-[(1R,2R)-2-(3-acetylsulfanyloctyl)-5-oxocyclopentyl]heptanoate.
Molecular Properties
| Compound Name | ethyl 7-[(1R,2R)-2-(3-acetylsulfanyloctyl)-5-oxocyclopentyl]heptanoate |
| PubChem CID | 18594874 |
| Molecular Formula | C24H42O4S |
| Molecular Weight | 426.66 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | ethyl 7-[(1R,2R)-2-(3-acetylsulfanyloctyl)-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCCC(CC[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)OCC)SC(C)=O |
| InChI | InChI=1S/C24H42O4S/c1-4-6-9-12-21(29-19(3)25)17-15-20-16-18-23(26)22(20)13-10-7-8-11-14-24(27)28-5-2/h20-22H,4-18H2,1-3H3/t20-,21?,22+/m0/s1 |
| InChIKey | DPAMZEFPGZVXPO-JAFNVKOHSA-N |
| XLogP | 6.49 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.66 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze ethyl 7-[(1R,2R)-2-(3-acetylsulfanyloctyl)-5-oxocyclopentyl]heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-[(1R,2R)-2-(3-acetylsulfanyloctyl)-5-oxocyclopentyl]heptanoate?
The IUPAC name of ethyl 7-[(1R,2R)-2-(3-acetylsulfanyloctyl)-5-oxocyclopentyl]heptanoate (CID 18594874) is ethyl 7-[(1R,2R)-2-(3-acetylsulfanyloctyl)-5-oxocyclopentyl]heptanoate.
What is the SMILES notation for ethyl 7-[(1R,2R)-2-(3-acetylsulfanyloctyl)-5-oxocyclopentyl]heptanoate?
The canonical SMILES for ethyl 7-[(1R,2R)-2-(3-acetylsulfanyloctyl)-5-oxocyclopentyl]heptanoate is CCCCCC(CC[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)OCC)SC(C)=O.
What is the InChIKey of ethyl 7-[(1R,2R)-2-(3-acetylsulfanyloctyl)-5-oxocyclopentyl]heptanoate?
The InChIKey is DPAMZEFPGZVXPO-JAFNVKOHSA-N. The full InChI is InChI=1S/C24H42O4S/c1-4-6-9-12-21(29-19(3)25)17-15-20-16-18-23(26)22(20)13-10-7-8-11-14-24(27)28-5-2/h20-22H,4-18H2,1-3H3/t20-,21?,22+/m0/s1.
What are the key properties of ethyl 7-[(1R,2R)-2-(3-acetylsulfanyloctyl)-5-oxocyclopentyl]heptanoate?
ethyl 7-[(1R,2R)-2-(3-acetylsulfanyloctyl)-5-oxocyclopentyl]heptanoate has a molecular weight of 426.66 g/mol, XLogP of 6.49, 16 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-[(1R,2R)-2-(3-acetylsulfanyloctyl)-5-oxocyclopentyl]heptanoate is sourced from PubChem (CID 18594874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).