About 2-[4-[(1R,2S)-2-(3-hydroxyoctyl)-5-oxocyclopentyl]butylsulfanyl]acetic acid
2-[4-[(1R,2S)-2-(3-hydroxyoctyl)-5-oxocyclopentyl]butylsulfanyl]acetic acid (PubChem CID 18595063) has the molecular formula C19H34O4S
and a molecular weight of 358.54 g/mol. Its IUPAC name is 2-[4-[(1R,2S)-2-(3-hydroxyoctyl)-5-oxocyclopentyl]butylsulfanyl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-[(1R,2S)-2-(3-hydroxyoctyl)-5-oxocyclopentyl]butylsulfanyl]acetic acid |
| PubChem CID | 18595063 |
| Molecular Formula | C19H34O4S |
| Molecular Weight | 358.54 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 2-[4-[(1R,2S)-2-(3-hydroxyoctyl)-5-oxocyclopentyl]butylsulfanyl]acetic acid |
| SMILES | CCCCCC(O)CC[C@H]1CCC(=O)[C@@H]1CCCCSCC(=O)O |
| InChI | InChI=1S/C19H34O4S/c1-2-3-4-7-16(20)11-9-15-10-12-18(21)17(15)8-5-6-13-24-14-19(22)23/h15-17,20H,2-14H2,1H3,(H,22,23)/t15-,16?,17+/m0/s1 |
| InChIKey | GAQKSWFJOBXHBX-RPCGPGEBSA-N |
| XLogP | 4.29 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(1R,2S)-2-(3-hydroxyoctyl)-5-oxocyclopentyl]butylsulfanyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(1R,2S)-2-(3-hydroxyoctyl)-5-oxocyclopentyl]butylsulfanyl]acetic acid?
The IUPAC name of 2-[4-[(1R,2S)-2-(3-hydroxyoctyl)-5-oxocyclopentyl]butylsulfanyl]acetic acid (CID 18595063) is 2-[4-[(1R,2S)-2-(3-hydroxyoctyl)-5-oxocyclopentyl]butylsulfanyl]acetic acid.
What is the SMILES notation for 2-[4-[(1R,2S)-2-(3-hydroxyoctyl)-5-oxocyclopentyl]butylsulfanyl]acetic acid?
The canonical SMILES for 2-[4-[(1R,2S)-2-(3-hydroxyoctyl)-5-oxocyclopentyl]butylsulfanyl]acetic acid is CCCCCC(O)CC[C@H]1CCC(=O)[C@@H]1CCCCSCC(=O)O.
What is the InChIKey of 2-[4-[(1R,2S)-2-(3-hydroxyoctyl)-5-oxocyclopentyl]butylsulfanyl]acetic acid?
The InChIKey is GAQKSWFJOBXHBX-RPCGPGEBSA-N. The full InChI is InChI=1S/C19H34O4S/c1-2-3-4-7-16(20)11-9-15-10-12-18(21)17(15)8-5-6-13-24-14-19(22)23/h15-17,20H,2-14H2,1H3,(H,22,23)/t15-,16?,17+/m0/s1.
What are the key properties of 2-[4-[(1R,2S)-2-(3-hydroxyoctyl)-5-oxocyclopentyl]butylsulfanyl]acetic acid?
2-[4-[(1R,2S)-2-(3-hydroxyoctyl)-5-oxocyclopentyl]butylsulfanyl]acetic acid has a molecular weight of 358.54 g/mol, XLogP of 4.29, 14 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(1R,2S)-2-(3-hydroxyoctyl)-5-oxocyclopentyl]butylsulfanyl]acetic acid is sourced from PubChem (CID 18595063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).