C21H38O4S — CID 18595122
ethyl 2-[4-[(1R,2S)-2-(3-hydroxyoctyl)-5-oxocyclopentyl]butylsulfanyl]acetate (PubChem CID 18595122) has the molecular formula C21H38O4S and a molecular weight of 386.60 g/mol. Its IUPAC name is ethyl 2-[4-[(1R,2S)-2-(3-hydroxyoctyl)-5-oxocyclopentyl]butylsulfanyl]acetate.
| Compound Name | ethyl 2-[4-[(1R,2S)-2-(3-hydroxyoctyl)-5-oxocyclopentyl]butylsulfanyl]acetate |
|---|---|
| PubChem CID | 18595122 |
| Molecular Formula | C21H38O4S |
| Molecular Weight | 386.60 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | ethyl 2-[4-[(1R,2S)-2-(3-hydroxyoctyl)-5-oxocyclopentyl]butylsulfanyl]acetate |
| SMILES | CCCCCC(O)CC[C@H]1CCC(=O)[C@@H]1CCCCSCC(=O)OCC |
| InChI | InChI=1S/C21H38O4S/c1-3-5-6-9-18(22)13-11-17-12-14-20(23)19(17)10-7-8-15-26-16-21(24)25-4-2/h17-19,22H,3-16H2,1-2H3/t17-,18?,19+/m0/s1 |
| InChIKey | YDWUNRWZQFGIMR-LJJQOFDWSA-N |
| XLogP | 4.77 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.60 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|