About 2-hydroxy-7-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]heptanoic acid
2-hydroxy-7-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]heptanoic acid (PubChem CID 18595127) has the molecular formula C20H36O3
and a molecular weight of 324.51 g/mol. Its IUPAC name is 2-hydroxy-7-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]heptanoic acid.
Molecular Properties
| Compound Name | 2-hydroxy-7-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]heptanoic acid |
| PubChem CID | 18595127 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | 2-hydroxy-7-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]heptanoic acid |
| SMILES | CCCCCC/C=C/[C@H]1CCC[C@@H]1CCCCCC(O)C(=O)O |
| InChI | InChI=1S/C20H36O3/c1-2-3-4-5-6-8-12-17-14-11-15-18(17)13-9-7-10-16-19(21)20(22)23/h8,12,17-19,21H,2-7,9-11,13-16H2,1H3,(H,22,23)/b12-8+/t17-,18-,19?/m0/s1 |
| InChIKey | OMSXEQUQRZBEAA-JHSMTLKUSA-N |
| XLogP | 5.33 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-7-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]heptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-7-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]heptanoic acid?
The IUPAC name of 2-hydroxy-7-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]heptanoic acid (CID 18595127) is 2-hydroxy-7-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]heptanoic acid.
What is the SMILES notation for 2-hydroxy-7-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]heptanoic acid?
The canonical SMILES for 2-hydroxy-7-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]heptanoic acid is CCCCCC/C=C/[C@H]1CCC[C@@H]1CCCCCC(O)C(=O)O.
What is the InChIKey of 2-hydroxy-7-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]heptanoic acid?
The InChIKey is OMSXEQUQRZBEAA-JHSMTLKUSA-N. The full InChI is InChI=1S/C20H36O3/c1-2-3-4-5-6-8-12-17-14-11-15-18(17)13-9-7-10-16-19(21)20(22)23/h8,12,17-19,21H,2-7,9-11,13-16H2,1H3,(H,22,23)/b12-8+/t17-,18-,19?/m0/s1.
What are the key properties of 2-hydroxy-7-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]heptanoic acid?
2-hydroxy-7-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]heptanoic acid has a molecular weight of 324.51 g/mol, XLogP of 5.33, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-7-[(1S,2S)-2-[(E)-oct-1-enyl]cyclopentyl]heptanoic acid is sourced from PubChem (CID 18595127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).