C15H24O6 — CID 18595264
(5R,6S,7R,8R)-6,7,8,9-tetrahydroxy-5-prop-2-enoxy-5-prop-2-enylnon-1-en-4-one (PubChem CID 18595264) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is (5R,6S,7R,8R)-6,7,8,9-tetrahydroxy-5-prop-2-enoxy-5-prop-2-enylnon-1-en-4-one.
| Compound Name | (5R,6S,7R,8R)-6,7,8,9-tetrahydroxy-5-prop-2-enoxy-5-prop-2-enylnon-1-en-4-one |
|---|---|
| PubChem CID | 18595264 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (5R,6S,7R,8R)-6,7,8,9-tetrahydroxy-5-prop-2-enoxy-5-prop-2-enylnon-1-en-4-one |
| SMILES | C=CCO[C@@](CC=C)(C(=O)CC=C)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C15H24O6/c1-4-7-12(18)15(8-5-2,21-9-6-3)14(20)13(19)11(17)10-16/h4-6,11,13-14,16-17,19-20H,1-3,7-10H2/t11-,13-,14+,15+/m1/s1 |
| InChIKey | OXMFQVCRHCVKTQ-RZFFKMDDSA-N |
| XLogP | -0.28 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|