C27H34N2O5 — CID 18595937
dibutyl (4R,5S)-1,3-dibenzyl-2-oxoimidazolidine-4,5-dicarboxylate (PubChem CID 18595937) has the molecular formula C27H34N2O5 and a molecular weight of 466.58 g/mol. Its IUPAC name is dibutyl (4R,5S)-1,3-dibenzyl-2-oxoimidazolidine-4,5-dicarboxylate.
| Compound Name | dibutyl (4R,5S)-1,3-dibenzyl-2-oxoimidazolidine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 18595937 |
| Molecular Formula | C27H34N2O5 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | dibutyl (4R,5S)-1,3-dibenzyl-2-oxoimidazolidine-4,5-dicarboxylate |
| SMILES | CCCCOC(=O)[C@@H]1[C@H](C(=O)OCCCC)N(Cc2ccccc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C27H34N2O5/c1-3-5-17-33-25(30)23-24(26(31)34-18-6-4-2)29(20-22-15-11-8-12-16-22)27(32)28(23)19-21-13-9-7-10-14-21/h7-16,23-24H,3-6,17-20H2,1-2H3/t23-,24+ |
| InChIKey | ULDAEPCYQFDSRV-PSWAGMNNSA-N |
| XLogP | 4.55 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|