C25H30N2O5 — CID 18595938
dipropyl (4R,5S)-1,3-dibenzyl-2-oxoimidazolidine-4,5-dicarboxylate (PubChem CID 18595938) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is dipropyl (4R,5S)-1,3-dibenzyl-2-oxoimidazolidine-4,5-dicarboxylate.
| Compound Name | dipropyl (4R,5S)-1,3-dibenzyl-2-oxoimidazolidine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 18595938 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | dipropyl (4R,5S)-1,3-dibenzyl-2-oxoimidazolidine-4,5-dicarboxylate |
| SMILES | CCCOC(=O)[C@@H]1[C@H](C(=O)OCCC)N(Cc2ccccc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C25H30N2O5/c1-3-15-31-23(28)21-22(24(29)32-16-4-2)27(18-20-13-9-6-10-14-20)25(30)26(21)17-19-11-7-5-8-12-19/h5-14,21-22H,3-4,15-18H2,1-2H3/t21-,22+ |
| InChIKey | NSDMLBAFNDFXRE-SZPZYZBQSA-N |
| XLogP | 3.77 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |