C9H15N2O3S+ — CID 18596085
(2S,5R)-1-(aminomethyl)-3,3-dimethyl-7-oxo-4-thia-1-azoniabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 18596085) has the molecular formula C9H15N2O3S+ and a molecular weight of 231.30 g/mol. Its IUPAC name is (2S,5R)-1-(aminomethyl)-3,3-dimethyl-7-oxo-4-thia-1-azoniabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R)-1-(aminomethyl)-3,3-dimethyl-7-oxo-4-thia-1-azoniabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 18596085 |
| Molecular Formula | C9H15N2O3S+ |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | (2S,5R)-1-(aminomethyl)-3,3-dimethyl-7-oxo-4-thia-1-azoniabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@@H]2CC(=O)[N+]2(CN)[C@H]1C(=O)O |
| InChI | InChI=1S/C9H14N2O3S/c1-9(2)7(8(13)14)11(4-10)5(12)3-6(11)15-9/h6-7H,3-4,10H2,1-2H3/p+1/t6-,7+,11?/m1/s1 |
| InChIKey | GGZWQTWYESEOIE-ZBRSCZCWSA-O |
| XLogP | -0.05 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|