C16H24O10 — CID 18596296
3-hydroxy-4,4-dimethyloxolan-2-one;(1S,2R,6R,7R)-1,2,4,7-tetrahydroxy-3,3-dimethyl-5,9-dioxatricyclo[4.4.0.02,4]decan-10-one (PubChem CID 18596296) has the molecular formula C16H24O10 and a molecular weight of 376.36 g/mol. Its IUPAC name is 3-hydroxy-4,4-dimethyloxolan-2-one;(1S,2R,6R,7R)-1,2,4,7-tetrahydroxy-3,3-dimethyl-5,9-dioxatricyclo[4.4.0.02,4]decan-10-one.
| Compound Name | 3-hydroxy-4,4-dimethyloxolan-2-one;(1S,2R,6R,7R)-1,2,4,7-tetrahydroxy-3,3-dimethyl-5,9-dioxatricyclo[4.4.0.02,4]decan-10-one |
|---|---|
| PubChem CID | 18596296 |
| Molecular Formula | C16H24O10 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 3-hydroxy-4,4-dimethyloxolan-2-one;(1S,2R,6R,7R)-1,2,4,7-tetrahydroxy-3,3-dimethyl-5,9-dioxatricyclo[4.4.0.02,4]decan-10-one |
| SMILES | CC1(C)C2(O)O[C@@H]3[C@H](O)COC(=O)[C@@]3(O)[C@]12O.CC1(C)COC(=O)C1O |
| InChI | InChI=1S/C10H14O7.C6H10O3/c1-7(2)9(14)8(13)5(17-10(7,9)15)4(11)3-16-6(8)12;1-6(2)3-9-5(8)4(6)7/h4-5,11,13-15H,3H2,1-2H3;4,7H,3H2,1-2H3/t4-,5-,8-,9-,10?;/m1./s1 |
| InChIKey | JRRYCBOIDRGQOC-ZSFLILQZSA-N |
| XLogP | -2.58 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | -2.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |