C12H22O6 — CID 18596445
(1R)-1-[(1S,2S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2-dihydroxyethyl]-3,3-dimethylcyclopropane-1,2-diol (PubChem CID 18596445) has the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. Its IUPAC name is (1R)-1-[(1S,2S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2-dihydroxyethyl]-3,3-dimethylcyclopropane-1,2-diol.
| Compound Name | (1R)-1-[(1S,2S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2-dihydroxyethyl]-3,3-dimethylcyclopropane-1,2-diol |
|---|---|
| PubChem CID | 18596445 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (1R)-1-[(1S,2S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2-dihydroxyethyl]-3,3-dimethylcyclopropane-1,2-diol |
| SMILES | CC1(C)OC[C@H]([C@@H](O)[C@H](O)[C@]2(O)C(O)C2(C)C)O1 |
| InChI | InChI=1S/C12H22O6/c1-10(2)9(15)12(10,16)8(14)7(13)6-5-17-11(3,4)18-6/h6-9,13-16H,5H2,1-4H3/t6-,7-,8+,9?,12+/m1/s1 |
| InChIKey | ZLUGQEBPAJDRSP-WZWRAMDVSA-N |
| XLogP | -1.01 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |