C20H35NO2 — CID 18596616
1-butyl-4-(5-pentyl-1,3-dioxan-2-yl)cyclohexane-1-carbonitrile (PubChem CID 18596616) has the molecular formula C20H35NO2 and a molecular weight of 321.51 g/mol. Its IUPAC name is 1-butyl-4-(5-pentyl-1,3-dioxan-2-yl)cyclohexane-1-carbonitrile.
| Compound Name | 1-butyl-4-(5-pentyl-1,3-dioxan-2-yl)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 18596616 |
| Molecular Formula | C20H35NO2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.27 |
| IUPAC Name | 1-butyl-4-(5-pentyl-1,3-dioxan-2-yl)cyclohexane-1-carbonitrile |
| SMILES | CCCCCC1COC(C2CCC(C#N)(CCCC)CC2)OC1 |
| InChI | InChI=1S/C20H35NO2/c1-3-5-7-8-17-14-22-19(23-15-17)18-9-12-20(16-21,13-10-18)11-6-4-2/h17-19H,3-15H2,1-2H3 |
| InChIKey | LJIUQGOCJBCWMS-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|