C22H39NO2 — CID 18596680
1-(2-methoxyethoxymethyl)-4-(4-pentylcyclohexyl)cyclohexane-1-carbonitrile (PubChem CID 18596680) has the molecular formula C22H39NO2 and a molecular weight of 349.56 g/mol. Its IUPAC name is 1-(2-methoxyethoxymethyl)-4-(4-pentylcyclohexyl)cyclohexane-1-carbonitrile.
| Compound Name | 1-(2-methoxyethoxymethyl)-4-(4-pentylcyclohexyl)cyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 18596680 |
| Molecular Formula | C22H39NO2 |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.30 |
| IUPAC Name | 1-(2-methoxyethoxymethyl)-4-(4-pentylcyclohexyl)cyclohexane-1-carbonitrile |
| SMILES | CCCCCC1CCC(C2CCC(C#N)(COCCOC)CC2)CC1 |
| InChI | InChI=1S/C22H39NO2/c1-3-4-5-6-19-7-9-20(10-8-19)21-11-13-22(17-23,14-12-21)18-25-16-15-24-2/h19-21H,3-16,18H2,1-2H3 |
| InChIKey | ASDIBDJBJBMKMW-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|