C20H32O5 — CID 18597558
2-[2-[(1S,2S,3R,4R)-3-[(E)-4-cyclohexyl-3-hydroxybut-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]acetic acid (PubChem CID 18597558) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is 2-[2-[(1S,2S,3R,4R)-3-[(E)-4-cyclohexyl-3-hydroxybut-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]acetic acid.
| Compound Name | 2-[2-[(1S,2S,3R,4R)-3-[(E)-4-cyclohexyl-3-hydroxybut-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 18597558 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 2-[2-[(1S,2S,3R,4R)-3-[(E)-4-cyclohexyl-3-hydroxybut-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]acetic acid |
| SMILES | O=C(O)COCC[C@H]1[C@@H](/C=C/C(O)CC2CCCCC2)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C20H32O5/c21-15(12-14-4-2-1-3-5-14)6-7-16-17(10-11-24-13-20(22)23)19-9-8-18(16)25-19/h6-7,14-19,21H,1-5,8-13H2,(H,22,23)/b7-6+/t15?,16-,17+,18-,19+/m1/s1 |
| InChIKey | DLDYKQYGVPWWGR-XLFFCMRVSA-N |
| XLogP | 3.16 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|