C19H32O5 — CID 18597568
4-[2-[(1S,2S,3R,4R)-3-[(E)-3-hydroxyhept-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]butanoic acid (PubChem CID 18597568) has the molecular formula C19H32O5 and a molecular weight of 340.46 g/mol. Its IUPAC name is 4-[2-[(1S,2S,3R,4R)-3-[(E)-3-hydroxyhept-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]butanoic acid.
| Compound Name | 4-[2-[(1S,2S,3R,4R)-3-[(E)-3-hydroxyhept-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]butanoic acid |
|---|---|
| PubChem CID | 18597568 |
| Molecular Formula | C19H32O5 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 4-[2-[(1S,2S,3R,4R)-3-[(E)-3-hydroxyhept-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]butanoic acid |
| SMILES | CCCCC(O)/C=C/[C@@H]1[C@H](CCOCCCC(=O)O)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C19H32O5/c1-2-3-5-14(20)7-8-15-16(18-10-9-17(15)24-18)11-13-23-12-4-6-19(21)22/h7-8,14-18,20H,2-6,9-13H2,1H3,(H,21,22)/b8-7+/t14?,15-,16+,17-,18+/m1/s1 |
| InChIKey | HUYYRZRPRTYYHD-QYSAAALBSA-N |
| XLogP | 3.16 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|