C20H34O5 — CID 18597569
4-[2-[(1S,2S,3R,4R)-3-[(E)-3-hydroxyoct-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]butanoic acid (PubChem CID 18597569) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is 4-[2-[(1S,2S,3R,4R)-3-[(E)-3-hydroxyoct-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]butanoic acid.
| Compound Name | 4-[2-[(1S,2S,3R,4R)-3-[(E)-3-hydroxyoct-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]butanoic acid |
|---|---|
| PubChem CID | 18597569 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 4-[2-[(1S,2S,3R,4R)-3-[(E)-3-hydroxyoct-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]butanoic acid |
| SMILES | CCCCCC(O)/C=C/[C@@H]1[C@H](CCOCCCC(=O)O)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C20H34O5/c1-2-3-4-6-15(21)8-9-16-17(19-11-10-18(16)25-19)12-14-24-13-5-7-20(22)23/h8-9,15-19,21H,2-7,10-14H2,1H3,(H,22,23)/b9-8+/t15?,16-,17+,18-,19+/m1/s1 |
| InChIKey | VHLZMCFCMDRZHC-NFZKJTBBSA-N |
| XLogP | 3.55 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|