C21H34O5 — CID 18597572
4-[2-[(1R,2R,3S,4S)-3-[(E)-3-cyclohexyl-3-hydroxyprop-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]butanoic acid (PubChem CID 18597572) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is 4-[2-[(1R,2R,3S,4S)-3-[(E)-3-cyclohexyl-3-hydroxyprop-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]butanoic acid.
| Compound Name | 4-[2-[(1R,2R,3S,4S)-3-[(E)-3-cyclohexyl-3-hydroxyprop-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]butanoic acid |
|---|---|
| PubChem CID | 18597572 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 4-[2-[(1R,2R,3S,4S)-3-[(E)-3-cyclohexyl-3-hydroxyprop-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]butanoic acid |
| SMILES | O=C(O)CCCOCC[C@@H]1[C@H](/C=C/C(O)C2CCCCC2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C21H34O5/c22-18(15-5-2-1-3-6-15)9-8-16-17(20-11-10-19(16)26-20)12-14-25-13-4-7-21(23)24/h8-9,15-20,22H,1-7,10-14H2,(H,23,24)/b9-8+/t16-,17+,18?,19-,20+/m0/s1 |
| InChIKey | WTONZBLVPKAXKB-SLMLJUJYSA-N |
| XLogP | 3.55 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|