C15H20ClFO5 — CID 18597740
(3aR,5R,6S,6aR)-6-[(2-chlorofuran-3-yl)methoxy]-2-(fluoromethyl)-2-methyl-5-propyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 18597740) has the molecular formula C15H20ClFO5 and a molecular weight of 334.77 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-6-[(2-chlorofuran-3-yl)methoxy]-2-(fluoromethyl)-2-methyl-5-propyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-6-[(2-chlorofuran-3-yl)methoxy]-2-(fluoromethyl)-2-methyl-5-propyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 18597740 |
| Molecular Formula | C15H20ClFO5 |
| Molecular Weight | 334.77 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | (3aR,5R,6S,6aR)-6-[(2-chlorofuran-3-yl)methoxy]-2-(fluoromethyl)-2-methyl-5-propyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CCC[C@H]1O[C@@H]2OC(C)(CF)O[C@@H]2[C@H]1OCc1ccoc1Cl |
| InChI | InChI=1S/C15H20ClFO5/c1-3-4-10-11(19-7-9-5-6-18-13(9)16)12-14(20-10)22-15(2,8-17)21-12/h5-6,10-12,14H,3-4,7-8H2,1-2H3/t10-,11+,12-,14-,15?/m1/s1 |
| InChIKey | QDKDLRADZJIRAY-HYGHHBCGSA-N |
| XLogP | 3.44 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.77 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |