C16H22ClFO5 — CID 18597741
(3aR,5R,6S,6aR)-6-[(2-chlorofuran-3-yl)methoxy]-2-(fluoromethyl)-2-methyl-5-(2-methylpropyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 18597741) has the molecular formula C16H22ClFO5 and a molecular weight of 348.80 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-6-[(2-chlorofuran-3-yl)methoxy]-2-(fluoromethyl)-2-methyl-5-(2-methylpropyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-6-[(2-chlorofuran-3-yl)methoxy]-2-(fluoromethyl)-2-methyl-5-(2-methylpropyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 18597741 |
| Molecular Formula | C16H22ClFO5 |
| Molecular Weight | 348.80 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (3aR,5R,6S,6aR)-6-[(2-chlorofuran-3-yl)methoxy]-2-(fluoromethyl)-2-methyl-5-(2-methylpropyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CC(C)C[C@H]1O[C@@H]2OC(C)(CF)O[C@@H]2[C@H]1OCc1ccoc1Cl |
| InChI | InChI=1S/C16H22ClFO5/c1-9(2)6-11-12(20-7-10-4-5-19-14(10)17)13-15(21-11)23-16(3,8-18)22-13/h4-5,9,11-13,15H,6-8H2,1-3H3/t11-,12+,13-,15-,16?/m1/s1 |
| InChIKey | XHZLVFKEAFOCSJ-FETWPZQLSA-N |
| XLogP | 3.69 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.80 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |