C14H18ClFO5 — CID 18597742
(3aR,5R,6S,6aR)-6-[(2-chlorofuran-3-yl)methoxy]-5-ethyl-2-(fluoromethyl)-2-methyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 18597742) has the molecular formula C14H18ClFO5 and a molecular weight of 320.74 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-6-[(2-chlorofuran-3-yl)methoxy]-5-ethyl-2-(fluoromethyl)-2-methyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-6-[(2-chlorofuran-3-yl)methoxy]-5-ethyl-2-(fluoromethyl)-2-methyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 18597742 |
| Molecular Formula | C14H18ClFO5 |
| Molecular Weight | 320.74 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | (3aR,5R,6S,6aR)-6-[(2-chlorofuran-3-yl)methoxy]-5-ethyl-2-(fluoromethyl)-2-methyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CC[C@H]1O[C@@H]2OC(C)(CF)O[C@@H]2[C@H]1OCc1ccoc1Cl |
| InChI | InChI=1S/C14H18ClFO5/c1-3-9-10(18-6-8-4-5-17-12(8)15)11-13(19-9)21-14(2,7-16)20-11/h4-5,9-11,13H,3,6-7H2,1-2H3/t9-,10+,11-,13-,14?/m1/s1 |
| InChIKey | RAWVBWIUBBAANG-YTHKFNTESA-N |
| XLogP | 3.05 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.74 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |