C17H25FO4S — CID 18597751
(3aR,5R,6S,6aR)-5-butyl-2-(fluoromethyl)-2-methyl-6-[(2-methylthiophen-3-yl)methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 18597751) has the molecular formula C17H25FO4S and a molecular weight of 344.45 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-5-butyl-2-(fluoromethyl)-2-methyl-6-[(2-methylthiophen-3-yl)methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-5-butyl-2-(fluoromethyl)-2-methyl-6-[(2-methylthiophen-3-yl)methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 18597751 |
| Molecular Formula | C17H25FO4S |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (3aR,5R,6S,6aR)-5-butyl-2-(fluoromethyl)-2-methyl-6-[(2-methylthiophen-3-yl)methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CCCC[C@H]1O[C@@H]2OC(C)(CF)O[C@@H]2[C@H]1OCc1ccsc1C |
| InChI | InChI=1S/C17H25FO4S/c1-4-5-6-13-14(19-9-12-7-8-23-11(12)2)15-16(20-13)22-17(3,10-18)21-15/h7-8,13-16H,4-6,9-10H2,1-3H3/t13-,14+,15-,16-,17?/m1/s1 |
| InChIKey | NNFVADOCVCYHTP-AKWQBFHWSA-N |
| XLogP | 3.96 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |