C13H16F2O4S — CID 18597752
(3aR,5R,6S,6aR)-2-(fluoromethyl)-6-[(3-fluorothiophen-2-yl)methoxy]-2,5-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 18597752) has the molecular formula C13H16F2O4S and a molecular weight of 306.33 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-2-(fluoromethyl)-6-[(3-fluorothiophen-2-yl)methoxy]-2,5-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-2-(fluoromethyl)-6-[(3-fluorothiophen-2-yl)methoxy]-2,5-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 18597752 |
| Molecular Formula | C13H16F2O4S |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | (3aR,5R,6S,6aR)-2-(fluoromethyl)-6-[(3-fluorothiophen-2-yl)methoxy]-2,5-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | C[C@H]1O[C@@H]2OC(C)(CF)O[C@@H]2[C@H]1OCc1sccc1F |
| InChI | InChI=1S/C13H16F2O4S/c1-7-10(16-5-9-8(15)3-4-20-9)11-12(17-7)19-13(2,6-14)18-11/h3-4,7,10-12H,5-6H2,1-2H3/t7-,10+,11-,12-,13?/m1/s1 |
| InChIKey | HQMLEPOYMBEFDY-IPBZOLOVSA-N |
| XLogP | 2.62 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |