C16H22F2O5 — CID 18597757
(3aR,5R,6S,6aR)-2-(fluoromethyl)-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]-2-methyl-5-propyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 18597757) has the molecular formula C16H22F2O5 and a molecular weight of 332.34 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-2-(fluoromethyl)-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]-2-methyl-5-propyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-2-(fluoromethyl)-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]-2-methyl-5-propyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 18597757 |
| Molecular Formula | C16H22F2O5 |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | (3aR,5R,6S,6aR)-2-(fluoromethyl)-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]-2-methyl-5-propyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CCC[C@H]1O[C@@H]2OC(C)(CF)O[C@@H]2[C@H]1OCc1oc(F)cc1C |
| InChI | InChI=1S/C16H22F2O5/c1-4-5-10-13(19-7-11-9(2)6-12(18)20-11)14-15(21-10)23-16(3,8-17)22-14/h6,10,13-15H,4-5,7-8H2,1-3H3/t10-,13+,14-,15-,16?/m1/s1 |
| InChIKey | IWWNJUHOPIWAJA-UQNYZGSNSA-N |
| XLogP | 3.24 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |