C17H24F2O5 — CID 18597760
(5R,6S,6aR)-5-butyl-2-(fluoromethyl)-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]-2-methyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 18597760) has the molecular formula C17H24F2O5 and a molecular weight of 346.37 g/mol. Its IUPAC name is (5R,6S,6aR)-5-butyl-2-(fluoromethyl)-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]-2-methyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (5R,6S,6aR)-5-butyl-2-(fluoromethyl)-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]-2-methyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 18597760 |
| Molecular Formula | C17H24F2O5 |
| Molecular Weight | 346.37 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (5R,6S,6aR)-5-butyl-2-(fluoromethyl)-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]-2-methyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CCCC[C@H]1OC2OC(C)(CF)O[C@@H]2[C@H]1OCc1oc(F)cc1C |
| InChI | InChI=1S/C17H24F2O5/c1-4-5-6-11-14(20-8-12-10(2)7-13(19)21-12)15-16(22-11)24-17(3,9-18)23-15/h7,11,14-16H,4-6,8-9H2,1-3H3/t11-,14+,15-,16?,17?/m1/s1 |
| InChIKey | LHXICSIOPWMJTQ-UPEFBCLNSA-N |
| XLogP | 3.63 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |