C15H21FO4S — CID 18597766
(3aR,5R,6S,6aR)-2-(fluoromethyl)-2-methyl-5-propyl-6-(thiophen-3-ylmethoxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 18597766) has the molecular formula C15H21FO4S and a molecular weight of 316.39 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-2-(fluoromethyl)-2-methyl-5-propyl-6-(thiophen-3-ylmethoxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-2-(fluoromethyl)-2-methyl-5-propyl-6-(thiophen-3-ylmethoxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 18597766 |
| Molecular Formula | C15H21FO4S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (3aR,5R,6S,6aR)-2-(fluoromethyl)-2-methyl-5-propyl-6-(thiophen-3-ylmethoxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CCC[C@H]1O[C@@H]2OC(C)(CF)O[C@@H]2[C@H]1OCc1ccsc1 |
| InChI | InChI=1S/C15H21FO4S/c1-3-4-11-12(17-7-10-5-6-21-8-10)13-14(18-11)20-15(2,9-16)19-13/h5-6,8,11-14H,3-4,7,9H2,1-2H3/t11-,12+,13-,14-,15?/m1/s1 |
| InChIKey | WPVQBWNWUOLUSJ-PFNKYVCDSA-N |
| XLogP | 3.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |