C16H23FO4S — CID 18597769
(3aR,5R,6S,6aR)-5-butyl-2-(fluoromethyl)-2-methyl-6-(thiophen-3-ylmethoxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 18597769) has the molecular formula C16H23FO4S and a molecular weight of 330.42 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-5-butyl-2-(fluoromethyl)-2-methyl-6-(thiophen-3-ylmethoxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-5-butyl-2-(fluoromethyl)-2-methyl-6-(thiophen-3-ylmethoxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 18597769 |
| Molecular Formula | C16H23FO4S |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | (3aR,5R,6S,6aR)-5-butyl-2-(fluoromethyl)-2-methyl-6-(thiophen-3-ylmethoxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CCCC[C@H]1O[C@@H]2OC(C)(CF)O[C@@H]2[C@H]1OCc1ccsc1 |
| InChI | InChI=1S/C16H23FO4S/c1-3-4-5-12-13(18-8-11-6-7-22-9-11)14-15(19-12)21-16(2,10-17)20-14/h6-7,9,12-15H,3-5,8,10H2,1-2H3/t12-,13+,14-,15-,16?/m1/s1 |
| InChIKey | KQVDZPGVOHHVTF-KJAHXBPPSA-N |
| XLogP | 3.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |