C14H19FO4S — CID 18597783
(3aR,5R,6S,6aR)-2-ethyl-6-[(3-fluorothiophen-2-yl)methoxy]-2,5-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 18597783) has the molecular formula C14H19FO4S and a molecular weight of 302.37 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-2-ethyl-6-[(3-fluorothiophen-2-yl)methoxy]-2,5-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-2-ethyl-6-[(3-fluorothiophen-2-yl)methoxy]-2,5-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 18597783 |
| Molecular Formula | C14H19FO4S |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | (3aR,5R,6S,6aR)-2-ethyl-6-[(3-fluorothiophen-2-yl)methoxy]-2,5-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CCC1(C)O[C@H]2O[C@H](C)[C@H](OCc3sccc3F)[C@H]2O1 |
| InChI | InChI=1S/C14H19FO4S/c1-4-14(3)18-12-11(8(2)17-13(12)19-14)16-7-10-9(15)5-6-20-10/h5-6,8,11-13H,4,7H2,1-3H3/t8-,11+,12-,13-,14?/m1/s1 |
| InChIKey | ILQBNPVELLYZCT-MDUVNYLJSA-N |
| XLogP | 3.06 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |