C17H25FO5 — CID 18597788
(3aR,5R,6S,6aR)-2-ethyl-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]-2-methyl-5-propyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 18597788) has the molecular formula C17H25FO5 and a molecular weight of 328.38 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-2-ethyl-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]-2-methyl-5-propyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-2-ethyl-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]-2-methyl-5-propyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 18597788 |
| Molecular Formula | C17H25FO5 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (3aR,5R,6S,6aR)-2-ethyl-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]-2-methyl-5-propyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CCC[C@H]1O[C@@H]2OC(C)(CC)O[C@@H]2[C@H]1OCc1oc(F)cc1C |
| InChI | InChI=1S/C17H25FO5/c1-5-7-11-14(19-9-12-10(3)8-13(18)20-12)15-16(21-11)23-17(4,6-2)22-15/h8,11,14-16H,5-7,9H2,1-4H3/t11-,14+,15-,16-,17?/m1/s1 |
| InChIKey | LOXDUQXMJKRALV-NOLFWGJFSA-N |
| XLogP | 3.68 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |