C16H23FO5 — CID 18597790
(3aR,5R,6S,6aR)-2,5-diethyl-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]-2-methyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 18597790) has the molecular formula C16H23FO5 and a molecular weight of 314.35 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-2,5-diethyl-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]-2-methyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-2,5-diethyl-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]-2-methyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 18597790 |
| Molecular Formula | C16H23FO5 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (3aR,5R,6S,6aR)-2,5-diethyl-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]-2-methyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CC[C@H]1O[C@@H]2OC(C)(CC)O[C@@H]2[C@H]1OCc1oc(F)cc1C |
| InChI | InChI=1S/C16H23FO5/c1-5-10-13(18-8-11-9(3)7-12(17)19-11)14-15(20-10)22-16(4,6-2)21-14/h7,10,13-15H,5-6,8H2,1-4H3/t10-,13+,14-,15-,16?/m1/s1 |
| InChIKey | ZQIGMMKBDKDBNB-UQNYZGSNSA-N |
| XLogP | 3.29 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |