C18H27FO5 — CID 18597791
(3aR,5R,6S,6aR)-5-butyl-2-ethyl-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]-2-methyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 18597791) has the molecular formula C18H27FO5 and a molecular weight of 342.41 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-5-butyl-2-ethyl-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]-2-methyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-5-butyl-2-ethyl-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]-2-methyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 18597791 |
| Molecular Formula | C18H27FO5 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (3aR,5R,6S,6aR)-5-butyl-2-ethyl-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]-2-methyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CCCC[C@H]1O[C@@H]2OC(C)(CC)O[C@@H]2[C@H]1OCc1oc(F)cc1C |
| InChI | InChI=1S/C18H27FO5/c1-5-7-8-12-15(20-10-13-11(3)9-14(19)21-13)16-17(22-12)24-18(4,6-2)23-16/h9,12,15-17H,5-8,10H2,1-4H3/t12-,15+,16-,17-,18?/m1/s1 |
| InChIKey | BLWLJENZEZOKHC-FOZLQVMPSA-N |
| XLogP | 4.07 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |