C18H25FO5 — CID 18597823
(3aR,5R,6S,6aR)-5-ethyl-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane] (PubChem CID 18597823) has the molecular formula C18H25FO5 and a molecular weight of 340.39 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-5-ethyl-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane].
| Compound Name | (3aR,5R,6S,6aR)-5-ethyl-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane] |
|---|---|
| PubChem CID | 18597823 |
| Molecular Formula | C18H25FO5 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | (3aR,5R,6S,6aR)-5-ethyl-6-[(5-fluoro-3-methylfuran-2-yl)methoxy]spiro[3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-2,1'-cyclohexane] |
| SMILES | CC[C@H]1O[C@@H]2OC3(CCCCC3)O[C@@H]2[C@H]1OCc1oc(F)cc1C |
| InChI | InChI=1S/C18H25FO5/c1-3-12-15(20-10-13-11(2)9-14(19)21-13)16-17(22-12)24-18(23-16)7-5-4-6-8-18/h9,12,15-17H,3-8,10H2,1-2H3/t12-,15+,16-,17-/m1/s1 |
| InChIKey | IOJMQHIKWYJEPJ-VJUNAUMWSA-N |
| XLogP | 3.82 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |