C16H24O4S — CID 18597845
(3aR,5R,6S,6aR)-2-methyl-5-(2-methylpropyl)-6-[(2-methylthiophen-3-yl)methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 18597845) has the molecular formula C16H24O4S and a molecular weight of 312.43 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-2-methyl-5-(2-methylpropyl)-6-[(2-methylthiophen-3-yl)methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-2-methyl-5-(2-methylpropyl)-6-[(2-methylthiophen-3-yl)methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 18597845 |
| Molecular Formula | C16H24O4S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | (3aR,5R,6S,6aR)-2-methyl-5-(2-methylpropyl)-6-[(2-methylthiophen-3-yl)methoxy]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | Cc1sccc1CO[C@@H]1[C@H]2OC(C)O[C@H]2O[C@@H]1CC(C)C |
| InChI | InChI=1S/C16H24O4S/c1-9(2)7-13-14(15-16(20-13)19-11(4)18-15)17-8-12-5-6-21-10(12)3/h5-6,9,11,13-16H,7-8H2,1-4H3/t11?,13-,14+,15-,16+/m1/s1 |
| InChIKey | GDRVEZKDFNQOPZ-HJGRSGLPSA-N |
| XLogP | 3.47 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |