C13H17FO4S — CID 18597879
(3aR,5R,6S,6aR)-6-[(3-fluorothiophen-2-yl)methoxy]-2,2,5-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 18597879) has the molecular formula C13H17FO4S and a molecular weight of 288.34 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-6-[(3-fluorothiophen-2-yl)methoxy]-2,2,5-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-6-[(3-fluorothiophen-2-yl)methoxy]-2,2,5-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 18597879 |
| Molecular Formula | C13H17FO4S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | (3aR,5R,6S,6aR)-6-[(3-fluorothiophen-2-yl)methoxy]-2,2,5-trimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | C[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1sccc1F |
| InChI | InChI=1S/C13H17FO4S/c1-7-10(15-6-9-8(14)4-5-19-9)11-12(16-7)18-13(2,3)17-11/h4-5,7,10-12H,6H2,1-3H3/t7-,10+,11-,12-/m1/s1 |
| InChIKey | ILXJYMORSGACHK-UYZPKGHCSA-N |
| XLogP | 2.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |