C20H31N3 — CID 18597963
(1S,2S)-6-ethyl-8-methyl-3-propan-2-yl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene (PubChem CID 18597963) has the molecular formula C20H31N3 and a molecular weight of 313.49 g/mol. Its IUPAC name is (1S,2S)-6-ethyl-8-methyl-3-propan-2-yl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene.
| Compound Name | (1S,2S)-6-ethyl-8-methyl-3-propan-2-yl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene |
|---|---|
| PubChem CID | 18597963 |
| Molecular Formula | C20H31N3 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | (1S,2S)-6-ethyl-8-methyl-3-propan-2-yl-3,6,10-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene |
| SMILES | CCN1CCN(C(C)C)[C@@H]2C1C(C)=CN1C3=C(CCC=C3)C[C@@H]21 |
| InChI | InChI=1S/C20H31N3/c1-5-21-10-11-22(14(2)3)20-18-12-16-8-6-7-9-17(16)23(18)13-15(4)19(20)21/h7,9,13-14,18-20H,5-6,8,10-12H2,1-4H3/t18-,19?,20-/m0/s1 |
| InChIKey | AGIZJCKKNURXGX-WMEOFMBSSA-N |
| XLogP | 3.37 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |