C20H32BrN3 — CID 18597967
(1S)-6-ethyl-8-methyl-3-propan-2-yl-3,6-diaza-10-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene bromide (PubChem CID 18597967) has the molecular formula C20H32BrN3 and a molecular weight of 394.40 g/mol. Its IUPAC name is (1S)-6-ethyl-8-methyl-3-propan-2-yl-3,6-diaza-10-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene bromide.
| Compound Name | (1S)-6-ethyl-8-methyl-3-propan-2-yl-3,6-diaza-10-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene bromide |
|---|---|
| PubChem CID | 18597967 |
| Molecular Formula | C20H32BrN3 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | (1S)-6-ethyl-8-methyl-3-propan-2-yl-3,6-diaza-10-azoniatetracyclo[8.7.0.02,7.011,16]heptadeca-8,11(16),12-triene bromide |
| SMILES | CCN1CCN(C(C)C)C2C1C(C)=C[NH+]1C3=C(CCC=C3)C[C@@H]21.[Br-] |
| InChI | InChI=1S/C20H31N3.BrH/c1-5-21-10-11-22(14(2)3)20-18-12-16-8-6-7-9-17(16)23(18)13-15(4)19(20)21;/h7,9,13-14,18-20H,5-6,8,10-12H2,1-4H3;1H/t18-,19?,20?;/m0./s1 |
| InChIKey | KWPCJEOMHFZPPI-ZBMFEAOPSA-N |
| XLogP | -1.05 |
| TPSA | 10.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |