C15H27N — CID 18598171
(2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-amine (PubChem CID 18598171) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is (2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-amine.
| Compound Name | (2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-amine |
|---|---|
| PubChem CID | 18598171 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | (2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-amine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C\CN |
| InChI | InChI=1S/C15H27N/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11H,5-6,8,10,12,16H2,1-4H3/b14-9+,15-11- |
| InChIKey | BDKQVCHNTAJNJR-PVMFERMNSA-N |
| XLogP | 4.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|