C28H48N2O — CID 18598231
1-[2,6-dimethyl-1-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperazin-2-yl]ethanone (PubChem CID 18598231) has the molecular formula C28H48N2O and a molecular weight of 428.71 g/mol. Its IUPAC name is 1-[2,6-dimethyl-1-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperazin-2-yl]ethanone.
| Compound Name | 1-[2,6-dimethyl-1-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperazin-2-yl]ethanone |
|---|---|
| PubChem CID | 18598231 |
| Molecular Formula | C28H48N2O |
| Molecular Weight | 428.71 g/mol |
| Exact Mass | 428.38 |
| IUPAC Name | 1-[2,6-dimethyl-1-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperazin-2-yl]ethanone |
| SMILES | CC(=O)C1(C)CNCC(C)N1C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C28H48N2O/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)18-19-30-26(6)20-29-21-28(30,8)27(7)31/h12,14,16,18,26,29H,9-11,13,15,17,19-21H2,1-8H3/b23-14+,24-16+,25-18+ |
| InChIKey | YFFSEWDNTGJMKN-WCGUESEVSA-N |
| XLogP | 6.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.71 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|