C30H51ClN2O — CID 18598235
1-[1-(4-chlorobutyl)-4-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperazin-2-yl]ethanone (PubChem CID 18598235) has the molecular formula C30H51ClN2O and a molecular weight of 491.20 g/mol. Its IUPAC name is 1-[1-(4-chlorobutyl)-4-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperazin-2-yl]ethanone.
| Compound Name | 1-[1-(4-chlorobutyl)-4-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperazin-2-yl]ethanone |
|---|---|
| PubChem CID | 18598235 |
| Molecular Formula | C30H51ClN2O |
| Molecular Weight | 491.20 g/mol |
| Exact Mass | 490.37 |
| IUPAC Name | 1-[1-(4-chlorobutyl)-4-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperazin-2-yl]ethanone |
| SMILES | CC(=O)C1CN(C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)CCN1CCCCCl |
| InChI | InChI=1S/C30H51ClN2O/c1-25(2)12-9-13-26(3)14-10-15-27(4)16-11-17-28(5)18-21-32-22-23-33(20-8-7-19-31)30(24-32)29(6)34/h12,14,16,18,30H,7-11,13,15,17,19-24H2,1-6H3/b26-14+,27-16+,28-18+ |
| InChIKey | FYSKCNJGQJQKOF-RWGYFCLOSA-N |
| XLogP | 7.73 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.20 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|