C29H48N2O — CID 18598236
1-[1-prop-2-enyl-4-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperazin-2-yl]ethanone (PubChem CID 18598236) has the molecular formula C29H48N2O and a molecular weight of 440.72 g/mol. Its IUPAC name is 1-[1-prop-2-enyl-4-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperazin-2-yl]ethanone.
| Compound Name | 1-[1-prop-2-enyl-4-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperazin-2-yl]ethanone |
|---|---|
| PubChem CID | 18598236 |
| Molecular Formula | C29H48N2O |
| Molecular Weight | 440.72 g/mol |
| Exact Mass | 440.38 |
| IUPAC Name | 1-[1-prop-2-enyl-4-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperazin-2-yl]ethanone |
| SMILES | C=CCN1CCN(C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)CC1C(C)=O |
| InChI | InChI=1S/C29H48N2O/c1-8-19-31-22-21-30(23-29(31)28(7)32)20-18-27(6)17-11-16-26(5)15-10-14-25(4)13-9-12-24(2)3/h8,12,14,16,18,29H,1,9-11,13,15,17,19-23H2,2-7H3/b25-14+,26-16+,27-18+ |
| InChIKey | BOGBIYJLLVSPRW-CQYMONOFSA-N |
| XLogP | 6.89 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.72 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|