C27H46N2O — CID 18598240
1-[1-methyl-4-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperazin-2-yl]ethanone (PubChem CID 18598240) has the molecular formula C27H46N2O and a molecular weight of 414.68 g/mol. Its IUPAC name is 1-[1-methyl-4-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperazin-2-yl]ethanone.
| Compound Name | 1-[1-methyl-4-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperazin-2-yl]ethanone |
|---|---|
| PubChem CID | 18598240 |
| Molecular Formula | C27H46N2O |
| Molecular Weight | 414.68 g/mol |
| Exact Mass | 414.36 |
| IUPAC Name | 1-[1-methyl-4-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]piperazin-2-yl]ethanone |
| SMILES | CC(=O)C1CN(C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)CCN1C |
| InChI | InChI=1S/C27H46N2O/c1-22(2)11-8-12-23(3)13-9-14-24(4)15-10-16-25(5)17-18-29-20-19-28(7)27(21-29)26(6)30/h11,13,15,17,27H,8-10,12,14,16,18-21H2,1-7H3/b23-13+,24-15+,25-17+ |
| InChIKey | ZMSVJARSOFMTBZ-HBKYZHKXSA-N |
| XLogP | 6.34 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.68 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|