C29H40N4O2 — CID 18598513
(6aR)-N-cyclohexyl-N-(cyclohexylcarbamoyl)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide (PubChem CID 18598513) has the molecular formula C29H40N4O2 and a molecular weight of 476.67 g/mol. Its IUPAC name is (6aR)-N-cyclohexyl-N-(cyclohexylcarbamoyl)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide.
| Compound Name | (6aR)-N-cyclohexyl-N-(cyclohexylcarbamoyl)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 18598513 |
| Molecular Formula | C29H40N4O2 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | (6aR)-N-cyclohexyl-N-(cyclohexylcarbamoyl)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| SMILES | CN1CC(C(=O)N(C(=O)NC2CCCCC2)C2CCCCC2)CC2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C29H40N4O2/c1-32-18-20(15-24-23-13-8-14-25-27(23)19(17-30-25)16-26(24)32)28(34)33(22-11-6-3-7-12-22)29(35)31-21-9-4-2-5-10-21/h8,13-14,17,20-22,24,26,30H,2-7,9-12,15-16,18H2,1H3,(H,31,35)/t20?,24?,26-/m1/s1 |
| InChIKey | NZTJAZSUOKGWKI-IREOKEETSA-N |
| XLogP | 5.33 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |