C12H12N4O9S — CID 18598674
1-[[(2S,3S,5S)-2-carboxy-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptan-3-yl]methyl]triazole-4,5-dicarboxylic acid (PubChem CID 18598674) has the molecular formula C12H12N4O9S and a molecular weight of 388.31 g/mol. Its IUPAC name is 1-[[(2S,3S,5S)-2-carboxy-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptan-3-yl]methyl]triazole-4,5-dicarboxylic acid.
| Compound Name | 1-[[(2S,3S,5S)-2-carboxy-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptan-3-yl]methyl]triazole-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 18598674 |
| Molecular Formula | C12H12N4O9S |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 388.03 |
| IUPAC Name | 1-[[(2S,3S,5S)-2-carboxy-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptan-3-yl]methyl]triazole-4,5-dicarboxylic acid |
| SMILES | C[C@]1(Cn2nnc(C(=O)O)c2C(=O)O)[C@H](C(=O)O)N2C(=O)C[C@@H]2S1(=O)=O |
| InChI | InChI=1S/C12H12N4O9S/c1-12(3-15-7(10(20)21)6(9(18)19)13-14-15)8(11(22)23)16-4(17)2-5(16)26(12,24)25/h5,8H,2-3H2,1H3,(H,18,19)(H,20,21)(H,22,23)/t5-,8-,12-/m0/s1 |
| InChIKey | FYRMJUWYEDUBMF-WNBSSGNCSA-N |
| XLogP | -2.13 |
| TPSA | 197.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |