C16H20N4O9S — CID 18598675
(2S,3S,5S)-3-[[4,5-bis(ethoxycarbonyl)triazol-1-yl]methyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 18598675) has the molecular formula C16H20N4O9S and a molecular weight of 444.42 g/mol. Its IUPAC name is (2S,3S,5S)-3-[[4,5-bis(ethoxycarbonyl)triazol-1-yl]methyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,3S,5S)-3-[[4,5-bis(ethoxycarbonyl)triazol-1-yl]methyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 18598675 |
| Molecular Formula | C16H20N4O9S |
| Molecular Weight | 444.42 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | (2S,3S,5S)-3-[[4,5-bis(ethoxycarbonyl)triazol-1-yl]methyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CCOC(=O)c1nnn(C[C@@]2(C)[C@H](C(=O)O)N3C(=O)C[C@@H]3S2(=O)=O)c1C(=O)OCC |
| InChI | InChI=1S/C16H20N4O9S/c1-4-28-14(24)10-11(15(25)29-5-2)19(18-17-10)7-16(3)12(13(22)23)20-8(21)6-9(20)30(16,26)27/h9,12H,4-7H2,1-3H3,(H,22,23)/t9-,12-,16-/m0/s1 |
| InChIKey | PAQKRZZHOZBVFM-HCYDYPBKSA-N |
| XLogP | -1.17 |
| TPSA | 175.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.42 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |