C15H17IN4O9S — CID 18598678
dimethyl 1-[[(2S,3S,5S)-2-(iodomethoxycarbonyl)-3-methyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptan-3-yl]methyl]triazole-4,5-dicarboxylate (PubChem CID 18598678) has the molecular formula C15H17IN4O9S and a molecular weight of 556.29 g/mol. Its IUPAC name is dimethyl 1-[[(2S,3S,5S)-2-(iodomethoxycarbonyl)-3-methyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptan-3-yl]methyl]triazole-4,5-dicarboxylate.
| Compound Name | dimethyl 1-[[(2S,3S,5S)-2-(iodomethoxycarbonyl)-3-methyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptan-3-yl]methyl]triazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 18598678 |
| Molecular Formula | C15H17IN4O9S |
| Molecular Weight | 556.29 g/mol |
| Exact Mass | 555.98 |
| IUPAC Name | dimethyl 1-[[(2S,3S,5S)-2-(iodomethoxycarbonyl)-3-methyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptan-3-yl]methyl]triazole-4,5-dicarboxylate |
| SMILES | COC(=O)c1nnn(C[C@@]2(C)[C@H](C(=O)OCI)N3C(=O)C[C@@H]3S2(=O)=O)c1C(=O)OC |
| InChI | InChI=1S/C15H17IN4O9S/c1-15(5-19-10(13(23)28-3)9(17-18-19)12(22)27-2)11(14(24)29-6-16)20-7(21)4-8(20)30(15,25)26/h8,11H,4-6H2,1-3H3/t8-,11-,15-/m0/s1 |
| InChIKey | LZFZCYITUHLTOS-CYBUAMNDSA-N |
| XLogP | -1.10 |
| TPSA | 164.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.29 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|